LBF20406PH01
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7016 | |LipidBank=XPR7016 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7016 |
| LipidMaps | LMFA08020002 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406PH01.mol |
| |
| Structural Information | |
| Systematic Name | anandamide 0-phosphate |
| Common Name | |
| Symbol | |
| Formula | C22H38NO5P |
| Exact Mass | 427.2487598409999 |
| Average Mass | 427.51462100000003 |
| SMILES | C(CCCC=CCC=CCC=CCC=CCCCCC)(NCCOP(O)(O)=O)=O |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.34-5.42 (m, 8H), 3.98 (br s 2H), 3.46 (br s 2H), 2.77-2.81 (m, 6H), 2.26 (t, J=6.8Hz, 2H), 2.00-2.06 (m, 4H), 1.60-1.69 (m, 2H), 1.29-1.42 (m, 6H), 0.88 (t, J=6.9Hz,3H) <<7001>> |
| Chromatograms | |
