LBF20406PG02
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR1766 | |LipidBank=XPR1766 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR1766 |
| LipidMaps | LMFA03010021 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406PG02.mol |
| 15-deoxy-Delta^{12.14}-Prostaglandin J2 | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 11-oxo-prosta-5Z,9,12E,14Z-tetraen-1-oic acid |
| Common Name |
|
| Symbol | |
| Formula | C20H28O3 |
| Exact Mass | 316.203844762 |
| Average Mass | 316.43452 |
| SMILES | C(CC=CC=C(C(=O)1)[C@@H](CC=CCCCC(O)=O)C=C1)CCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
