LBF20406LT01
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR3001 | |LipidBank=XPR3001 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR3001 |
| LipidMaps | LMFA03020023 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406LT01.mol |
| LEUKOTRIENE A4 | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5 (S) ,6 (S) -Epoxyeicosa-7 (E) ,9 (E) ,11 (Z) ,14 (Z) -tetraenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C20H30O3 |
| Exact Mass | 318.21949482599996 |
| Average Mass | 318.4504 |
| SMILES | C(CC=CCC=CC=CC=C[C@@H](O1)[C@@H]1CCCC(O)=O)CCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | [a]XD25=-21.9°(C=0.32,CYCLOHEXANE) <<1024>> |
| Solubility | SOL. IN CYCLOHEXANE,METHANOL<<1024>>. STABILITIES : to decompose to 5,12-DIHYDROXY-6,8,10,14-EICOSATETRAENOIC ACID and 5,6-DIHYDROXY-7,9,11,14-EICOSATETRAENOIC ACID under neutral aqueous solution at 37°C with one minite of half-life<<1030>>. |
| Spectral Information | |
| Mass Spectra | METHYL ESTER ; 332(M+), 316, 300, 221, 189, 181, 129, 101 <<1029>> |
| UV Spectra | METHYL ESTER ; l MeOHmax = 269(e 30,500), 278(e 40,000), 287(e 34,400) nm <<1031>> |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
