LBF20406HO15
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8133 | |LipidBank=DFA8133 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8133 |
LipidMaps | LMFA03060027 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406HO15.mol |
![]() | |
Structural Information | |
Systematic Name | 9S-hydroxy-5Z,7E,11Z,14Z-eicosatetraenoic acid |
Common Name | |
Symbol | |
Formula | C20H32O3 |
Exact Mass | 320.23514489 |
Average Mass | 320.46628 |
SMILES | C(CC=CCC=CC[C@@H](C=CC=CCCCC(O)=O)O)CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | lmax: 235nm e: 27,000 |
IR Spectra | |
NMR Spectra | |
Chromatograms |