LBF20406AM28
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7045 | |LipidBank=XPR7045 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7045 |
| LipidMaps | - |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM28.mol |
| |
| Structural Information | |
| Systematic Name | alpha-methyl anandamide |
| Common Name | |
| Symbol | |
| Formula | C23H39NO2 |
| Exact Mass | 361.298079497 |
| Average Mass | 361.5613 |
| SMILES | CC(C(=O)NCCO)CCC=CCC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d6.10 (br s lH), 5.22-5.40 (m, 8H), 3.75 (t, J=5.1Hz, 2H), 3.42 (q, J=4.9 Hz, 2H), 2.74-2.86 (m, 6H), 2.20-2.30 (m, lH), 2.00-2.12 (m, 4H), 1.68-1.80 (m, lH), 1.20-1.50 (m, 6H), 1.16 (d, J=6.6Hz, 3H), 0.89 (t, J=6.9Hz, 3H). <<7001>> |
| Chromatograms | |
