LBF20406AM27
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7043 | |LipidBank=XPR7043 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7043 |
LipidMaps | LMFA08020029 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM27.mol |
![]() | |
Structural Information | |
Systematic Name | N-hydroxy -N-arachidonoyl amide |
Common Name | |
Symbol | |
Formula | C20H33NO2 |
Exact Mass | 319.251129305 |
Average Mass | 319.48156 |
SMILES | C(CC=CCC=CCC=CCC=CCCCC(NO)=O)CCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.30-5.43 (m, 8H), 2.78-2.86 (m, 6H), 2.02-2.17 (m, 6H), l.70-1.78(m, 2H), 1.22-1.38 (m, 6H), 0.89 (t, J=6.9 Hz, 3H). <<7001>> |
Chromatograms |