LBF20406AM25
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7041 | |LipidBank=XPR7041 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7041 |
| LipidMaps | LMFA08020027 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM25.mol |
| |
| Structural Information | |
| Systematic Name | N-propyl -N- (2-hydroxyethyl) arachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C25H43NO2 |
| Exact Mass | 389.329379625 |
| Average Mass | 389.61446 |
| SMILES | C(N(C(=O)CCCC=CCC=CCC=CCC=CCCCCC)CCO)CC |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.30-5.42 (m, 8H), 3.76 (t, J=4.9 Hz, 2H), 3.52 (t, J=4.4 Hz, 2H), 3.24 (t, J=8.l Hz, 2H), 2.79-2.86 (m, 6H), 2.35 (t, J=8.l Hz, 2H), 2.02-2.20 (m, 4H), 1.54-1.76 (m, 4H), 1.25-1.38 (m, 6H), 0.86-0.89 (m, 6H). <<7001>> |
| Chromatograms | |
