LBF20406AM12
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7028 | |LipidBank=XPR7028 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7028 |
| LipidMaps | LMFA08020014 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM12.mol |
| |
| Structural Information | |
| Systematic Name | N- (3-methylbutyl) arachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C25H43NO |
| Exact Mass | 373.334465003 |
| Average Mass | 373.61505999999997 |
| SMILES | O=C(NCCC(C)C)CCCC=CCC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.30-5.42 (m, 8H), 3.26 (q, J=3Hz, 2H), 2.76-2.86 (m, 6H), 2.02-2.20 (m, 6H), 1.68-1.78 (m, 2H), 1.54-1.64 (m, lH), 1.26-1.40 (m, 8H), 0.82-0.96 (m, 9H) <<7001>> |
| Chromatograms | |
