LBF20406AM12
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7028 | |LipidBank=XPR7028 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7028 |
LipidMaps | LMFA08020014 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM12.mol |
![]() | |
Structural Information | |
Systematic Name | N- (3-methylbutyl) arachidonoyl amide |
Common Name | |
Symbol | |
Formula | C25H43NO |
Exact Mass | 373.334465003 |
Average Mass | 373.61505999999997 |
SMILES | O=C(NCCC(C)C)CCCC=CCC=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.30-5.42 (m, 8H), 3.26 (q, J=3Hz, 2H), 2.76-2.86 (m, 6H), 2.02-2.20 (m, 6H), 1.68-1.78 (m, 2H), 1.54-1.64 (m, lH), 1.26-1.40 (m, 8H), 0.82-0.96 (m, 9H) <<7001>> |
Chromatograms |