LBF20406AM10
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7026 | |LipidBank=XPR7026 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7026 |
LipidMaps | LMFA08020012 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM10.mol |
![]() | |
Structural Information | |
Systematic Name | N-tert-butyl arachidonoyl amide |
Common Name | |
Symbol | |
Formula | C24H41NO |
Exact Mass | 359.318814939 |
Average Mass | 359.58847999999995 |
SMILES | C(=CCCCC(NC(C)(C)C)=O)CC=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CCCl3) d5.30-5.40 (m, |
Chromatograms |