LBF20406AM06
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7022 | |LipidBank=XPR7022 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7022 |
LipidMaps | LMFA08020008 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM06.mol |
![]() | |
Structural Information | |
Systematic Name | arachidonoyl amide |
Common Name | |
Symbol | |
Formula | C20H33NO |
Exact Mass | 303.256214683 |
Average Mass | 303.48215999999996 |
SMILES | C(CC=CCC=CCC=CCC=CCCCC(N)=O)CCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.82 (br s, lH), 5.31-5.42 (m, 8H), 2.79-2.85 (m, 6H), 2.23 (t, J=8.1Hz, 2H), 2.04-2.15 (m, 4H), 1.70-1.77 (m, 2H), 1.25-1.38 (m, 6H), 0.89 (t, J=6.8Hz,3H). <<7001>> |
Chromatograms |