LBF20306HO03
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8108 | |LipidBank=DFA8108 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8108 |
LipidMaps | LMFA03050008 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20306HO03.mol |
![]() | |
Structural Information | |
Systematic Name | (+-) 11,12-dihydroxy-5Z,8Z,14Z-eicosatrienoic acid |
Common Name | |
Symbol | |
Formula | C20H34O4 |
Exact Mass | 338.24570957599997 |
Average Mass | 338.48156 |
SMILES | C(CC=CCC(O)C(O)CC=CCC=CCCCC(O)=O)CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |