LBF19000XX01
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0263 | |LipidBank=DFA0263 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0263 |
| LipidMaps | - |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF19000XX01.mol |
| Lactobacillic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | omega- (2-n-Hexylcycloprop-1-enyl) decanoic acidDisagreement concerning structure in England and the United States ; also suggested to be 2-hexylcyclopropanedecanoic acid and omega- (2-n-octylcyclopropyl) octanoic acid. |
| Common Name |
|
| Symbol | |
| Formula | C19H36O2 |
| Exact Mass | 296.271530396 |
| Average Mass | 296.48794000000004 |
| SMILES | C(C(CCCCCCCCCC(O)=O)1)(CCCCCC)C1 |
| Physicochemical Information | |
| Melting Point | 27.8-28.8 °C |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in acetone, chloroform, ether and petroleum ether.<<0215>><<0243>><<0245>><<0246>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
