LBF18207HO05
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8030 | |LipidBank=DFA8030 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA8030 |
| LipidMaps | LMFA01050132 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18207HO05.mol |
| |
| Structural Information | |
| Systematic Name | 9,14-Dihydroxy-10,12-Octadecadienoic Acid |
| Common Name | |
| Symbol | |
| Formula | C18H32O4 |
| Exact Mass | 312.23005951199997 |
| Average Mass | 312.44428 |
| SMILES | CCCCC(O)C=CC=CC(O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | GC-EI-MS(after methanolysis and trimethylsilylation)<<8055>>: m/e=455[M-CH3], 439[M-OCH3], 413[M-(CH2)CH3], 323[413-HOTMS], 313[M-(CH2)7COOCH3], 259[SMTO=CH-(CH2)7COOCH3], 159[SMTO=CH- (CH2)3CH3]/ GC-EI-MS(after methanolysis, hydrogenation and trimethylsilylation)(074): m/e=459[M-CH3], 417[M-(CH2)3CH3], 388[(CH2)4-CH(OTMS)-(CH2)7COOCH3] |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
