LBF161nnPG01
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR1421 | |LipidBank=XPR1421 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR1421 |
| LipidMaps | LMFA03010136 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF161nnPG01.mol |
| PROSTAGLANDIN E-MAJOR URINARY METABOLITE | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 8- [ 2 (R) - (2-Carboxyethyl) -5 (R) -hydroxy-3-oxocyclopentan-1 (R) -yl ] -6-oxooctanoic acid |
| Common Name |
|
| Symbol | |
| Formula | C16H24O7 |
| Exact Mass | 328.152203122 |
| Average Mass | 328.35756000000003 |
| SMILES | OC(=O)CCCCC(=O)CC[C@@H]([C@H](O)1)[C@@H](CCC(O)=O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | ETHYL ACETATE <<1061>> |
| Spectral Information | |
| Mass Spectra | DIMETHYL ESTER DI-O-METHYLOXIME TMS ETHER DERIVATIVE ; m/e 486, 455, 369, 365, 355, 286, 279, 268, 265, 196, 115 <<1061>> |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
