LBF16000OX07
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}}  | ||
| + | |||
{{Metabolite  | {{Metabolite  | ||
|LipidBank=DFA0440  | |LipidBank=DFA0440  | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0440 | 
| LipidMaps | LMFA01060056 | 
| CAS | |
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | LBF16000OX07.mol | 
| 9-Ketopalmitic acid | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 9-Oxohexadecanoic acid | 
| Common Name | 
  | 
| Symbol | |
| Formula | C16H30O3 | 
| Exact Mass | 270.21949482599996 | 
| Average Mass | 270.4076 | 
| SMILES | CCCCCCCC(=O)CCCCCCCC(O)=O | 
| Physicochemical Information | |
| Melting Point | 73.5-74.5°C | 
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | <<0154>> | 
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
