FLNA29NS0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|SysName=7-Hydroxy-6-methoxy-4-phenylcoumarin | |SysName=7-Hydroxy-6-methoxy-4-phenylcoumarin | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLN Neoflavonoid : FLNA 4-Arylcoumarin : FLNA29 6,7,(3'),(5')-Trihydroxy-4-phenylcoumarin and O-methyl derivatives (4 pages) : FLNA29NS Simple substitution (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 605-09-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLNA29NS0003.mol |
| Isodalbergin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Hydroxy-6-methoxy-4-phenylcoumarin |
| Common Name |
|
| Symbol | |
| Formula | C16H12O4 |
| Exact Mass | 268.073558872 |
| Average Mass | 268.26408 |
| SMILES | COc(c(O)3)cc(c2c3)C(=CC(=O)O2)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
