FLID1CNF0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=Ficinin | + | |SysName=Ficinin |
|Common Name=&&Ficinin&&4-Methoxyneodulin&& | |Common Name=&&Ficinin&&4-Methoxyneodulin&& | ||
|CAS=10338-03-1 | |CAS=10338-03-1 | ||
|KNApSAcK=C00009646 | |KNApSAcK=C00009646 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 10338-03-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLID1CNF0003.mol |
| Ficinin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Ficinin |
| Common Name |
|
| Symbol | |
| Formula | C19H14O6 |
| Exact Mass | 338.07903818 |
| Average Mass | 338.31086000000005 |
| SMILES | c(c56)c(O4)c(cc5OCO6)C(C41)COc(c3OC)c(cc(c32)cco2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
