FLIC3LNS0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|SysName= (+-) -7,2'-Dihydroxy-8,3',4'-trimethoxyisoflavan | |SysName= (+-) -7,2'-Dihydroxy-8,3',4'-trimethoxyisoflavan | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIC Isoflavan : FLIC3L 7,8,2',(3'),4',(5'),(6')-Hydroxyisoflavan and O-methyl derivatives (3 pages) : FLIC3LNS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 101153-40-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIC3LNS0003.mol |
| Isoduartin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (+-) -7,2'-Dihydroxy-8,3',4'-trimethoxyisoflavan |
| Common Name |
|
| Symbol | |
| Formula | C18H20O6 |
| Exact Mass | 332.125988372 |
| Average Mass | 332.3478 |
| SMILES | c(c1O)(OC)c(OC)ccc1C(C3)Cc(c2O3)ccc(c2OC)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
