FLIC1LNS0011
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=7,3'-Dihydroxy-2',4'-dimethoxyisoflavan | |SysName=7,3'-Dihydroxy-2',4'-dimethoxyisoflavan | ||
| − | |Common Name=&&(+-)-Mucronulatol&&7,3'-Dihydroxy-2',4'-dimethoxyisoflavan&& | + | |Common Name=&& (+-) -Mucronulatol&&7,3'-Dihydroxy-2',4'-dimethoxyisoflavan&& |
|CAS=20878-98-2 | |CAS=20878-98-2 | ||
|KNApSAcK=C00009715 | |KNApSAcK=C00009715 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 20878-98-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIC1LNS0011.mol |
| (+-) -Mucronulatol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7,3'-Dihydroxy-2',4'-dimethoxyisoflavan |
| Common Name |
|
| Symbol | |
| Formula | C17H18O5 |
| Exact Mass | 302.115423686 |
| Average Mass | 302.32182 |
| SMILES | COc(c3)c(O)c(OC)c(c3)C(C1)Cc(c2)c(cc(O)c2)O1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
