FLIB1LNS0010
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=7-Hydroxy-2',3',4'-trimethoxyisoflavanone |
|Common Name=&&3'-O-Methylviolanone&&7-Hydroxy-2',3',4'-trimethoxyisoflavanone&& | |Common Name=&&3'-O-Methylviolanone&&7-Hydroxy-2',3',4'-trimethoxyisoflavanone&& | ||
|CAS=56973-42-3 | |CAS=56973-42-3 | ||
|KNApSAcK=C00009545 | |KNApSAcK=C00009545 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 56973-42-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLIB1LNS0010.mol |
3'-O-Methylviolanone | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C18H18O6 |
Exact Mass | 330.110338308 |
Average Mass | 330.33191999999997 |
SMILES | c(c3OC)(OC)ccc(c3OC)C(C2=O)COc(c21)cc(O)cc1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|