FLIAECNS0011
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=Belamcandin | + | |SysName=Belamcandin |
|Common Name=&&Belamcandin&&5-Hydroxy-6,7,3',4'-tetramethoxyisoflavone&& | |Common Name=&&Belamcandin&&5-Hydroxy-6,7,3',4'-tetramethoxyisoflavone&& | ||
|CAS=78134-88-0 | |CAS=78134-88-0 | ||
|KNApSAcK=C00009860 | |KNApSAcK=C00009860 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 78134-88-0 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLIAECNS0011.mol |
Belamcandin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Belamcandin |
Common Name |
|
Symbol | |
Formula | C19H18O7 |
Exact Mass | 358.10525293 |
Average Mass | 358.34202000000005 |
SMILES | c(c3OC)(OC)cc(c(c3O)1)OC=C(c(c2)cc(OC)c(OC)c2)C1=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|