FLIAECGS0003
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=3-(4-Hydroxy-3-methoxyphenyl)-7-(beta-D-glucopyranosyloxy)-5-hydroxy-6-methoxy-4H-1-benzopyran-4-one | + | |SysName=3- (4-Hydroxy-3-methoxyphenyl) -7- (beta-D-glucopyranosyloxy) -5-hydroxy-6-methoxy-4H-1-benzopyran-4-one |
− | |Common Name=&&Iristectorigenin B 7-O-glucoside&&Iristectorin B&&3-(4-Hydroxy-3-methoxyphenyl)-7-(beta-D-glucopyranosyloxy)-5-hydroxy-6-methoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&Iristectorigenin B 7-O-glucoside&&Iristectorin B&&3- (4-Hydroxy-3-methoxyphenyl) -7- (beta-D-glucopyranosyloxy) -5-hydroxy-6-methoxy-4H-1-benzopyran-4-one&& |
|CAS=94396-09-5 | |CAS=94396-09-5 | ||
|KNApSAcK=C00010132 | |KNApSAcK=C00010132 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 94396-09-5 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLIAECGS0003.mol |
Iristectorigenin B 7-O-glucoside | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 3- (4-Hydroxy-3-methoxyphenyl) -7- (beta-D-glucopyranosyloxy) -5-hydroxy-6-methoxy-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C23H24O12 |
Exact Mass | 492.126776232 |
Average Mass | 492.42946 |
SMILES | COc(c3O[C@@H]([C@@H](O)4)OC(CO)[C@@H]([C@@H]4O)O)c |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|