FLIA19NM0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=7-Methoxy-2-methylisoflavone |
|Common Name=&&7-Methoxy-2-methylisoflavone&& | |Common Name=&&7-Methoxy-2-methylisoflavone&& | ||
|CAS=19725-44-1 | |CAS=19725-44-1 | ||
|KNApSAcK=C00009381 | |KNApSAcK=C00009381 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 19725-44-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIA19NM0002.mol |
| 7-Methoxy-2-methylisoflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Methoxy-2-methylisoflavone |
| Common Name |
|
| Symbol | |
| Formula | C17H14O3 |
| Exact Mass | 266.09429431399997 |
| Average Mass | 266.29125999999997 |
| SMILES | COc(c3)cc(O1)c(c3)C(=O)C(c(c2)cccc2)=C(C)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
