FL7DAAGO0002
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=??5,7,4'-Trihydroxyflavylium 7-glucoside |
|Common Name=&&Apigeninidin 7-glucoside&& | |Common Name=&&Apigeninidin 7-glucoside&& | ||
|CAS=53948-06-4 | |CAS=53948-06-4 | ||
|KNApSAcK=C00006621 | |KNApSAcK=C00006621 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 53948-06-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL7DAAGO0002.mol |
Apigeninidin 7-glucoside | |
---|---|
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C21H21O9 |
Exact Mass | 417.11855727 |
Average Mass | 417.38604 |
SMILES | Oc(c4)ccc(c4)c(c3)[o+1]c(c(c3)2)cc(cc2O)OC(O1)C(O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |