FL6FA9NI0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2S)-8-(3-Hydroxy-3-methylbutyl)-5,7-dimethoxy-2alpha-phenylchroman | + | |SysName= (2S) -8- (3-Hydroxy-3-methylbutyl) -5,7-dimethoxy-2alpha-phenylchroman |
| − | |Common Name=&&Nitenin&&(2S)-8-(3-Hydroxy-3-methylbutyl)-5,7-dimethoxy-2alpha-phenylchroman&& | + | |Common Name=&&Nitenin&& (2S) -8- (3-Hydroxy-3-methylbutyl) -5,7-dimethoxy-2alpha-phenylchroman&& |
|CAS=92590-02-8 | |CAS=92590-02-8 | ||
|KNApSAcK=C00008786 | |KNApSAcK=C00008786 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 92590-02-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6FA9NI0002.mol |
| Nitenin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2S) -8- (3-Hydroxy-3-methylbutyl) -5,7-dimethoxy-2alpha-phenylchroman |
| Common Name |
|
| Symbol | |
| Formula | C22H28O4 |
| Exact Mass | 356.19875938399997 |
| Average Mass | 356.45532000000003 |
| SMILES | O([C@@H]2c(c3)cccc3)c(c(CCC(C)(C)O)1)c(CC2)c(OC)cc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
