FL63ACGS0010
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 88126-53-8 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL63ACGS0010.mol |
Catechin 5-O-beta-D-glucopyranoside | |
---|---|
Structural Information | |
Systematic Name | (2R,3S)-5-(beta-D-Glucopyranosyloxy)-3,4-dihydro-2-(3,4-dihydroxyphenyl)-2H-1-benzopyran-3,7-diol |
Common Name |
|
Symbol | |
Formula | C21H24O11 |
Exact Mass | 452.13186161 |
Average Mass | 452.40866 |
SMILES | C(C1Oc(c4)c(c(cc(O)4)2)CC(C(c(c3)cc(c(O)c3)O)O2)O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|