FL5FECNSS006
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |Sysname=3,5,7,4'-Tetrahydroxy-6,3'-dimethoxyflavone 3-O-sulfate |
|Common Name=&&Spinacetin 3-O-sulfate&& | |Common Name=&&Spinacetin 3-O-sulfate&& | ||
|CAS=111348-30-2 | |CAS=111348-30-2 | ||
|KNApSAcK=C00004982 | |KNApSAcK=C00004982 | ||
}} | }} | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 111348-30-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FECNSS006.mol |
| Spinacetin 3-O-sulfate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | |
| Common Name |
|
| Symbol | |
| Formula | C17H14O11S |
| Exact Mass | 426.02568198 |
| Average Mass | 426.35246000000006 |
| SMILES | COc(c(O)3)cc(cc3)C(O1)=C(OS(O)(=O)=O)C(=O)c(c(O)2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
