FL5FECNS0005
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4H-1-benzopyran-4-one |
|Common Name=&&Patuletin&&3,5,7,3',4'-Pentahydroxy-6-methoxyflavone&&6-Methoxyquercetin&&2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4H-1-benzopyran-4-one&& | |Common Name=&&Patuletin&&3,5,7,3',4'-Pentahydroxy-6-methoxyflavone&&6-Methoxyquercetin&&2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4H-1-benzopyran-4-one&& | ||
|CAS=519-96-0 | |CAS=519-96-0 | ||
|KNApSAcK=C00004680 | |KNApSAcK=C00004680 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 519-96-0 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FECNS0005.mol |
Patuletin | |
---|---|
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C16H12O8 |
Exact Mass | 332.05321735999996 |
Average Mass | 332.26168 |
SMILES | COc(c(O)3)c(O)c(C(=O)1)c(c3)OC(c(c2)cc(O)c(O)c2)=C |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |