FL5FECNS0005
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=Patuletin | + | |SysName=Patuletin |
|Common Name=&&Patuletin&&3,5,7,3',4'-Pentahydroxy-6-methoxyflavone&&6-Methoxyquercetin&&2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4H-1-benzopyran-4-one&& | |Common Name=&&Patuletin&&3,5,7,3',4'-Pentahydroxy-6-methoxyflavone&&6-Methoxyquercetin&&2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4H-1-benzopyran-4-one&& | ||
|CAS=519-96-0 | |CAS=519-96-0 | ||
|KNApSAcK=C00004680 | |KNApSAcK=C00004680 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 519-96-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FECNS0005.mol |
| Patuletin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Patuletin |
| Common Name |
|
| Symbol | |
| Formula | C16H12O8 |
| Exact Mass | 332.05321735999996 |
| Average Mass | 332.26168 |
| SMILES | COc(c(O)3)c(O)c(C(=O)1)c(c3)OC(c(c2)cc(O)c(O)c2)=C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
