FL5FEANS0009
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,6-Dihydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one | + | |SysName=5,6-Dihydroxy-2- (4-hydroxyphenyl) -3,7-dimethoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&5,6,4'-Trihydroxy-3,7-dimethoxyflavone&&6-Hydroxykaempferol 3,7-dimethyl ether&&5,6-Dihydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&5,6,4'-Trihydroxy-3,7-dimethoxyflavone&&6-Hydroxykaempferol 3,7-dimethyl ether&&5,6-Dihydroxy-2- (4-hydroxyphenyl) -3,7-dimethoxy-4H-1-benzopyran-4-one&& |
|CAS=56226-95-0 | |CAS=56226-95-0 | ||
|KNApSAcK=C00004597 | |KNApSAcK=C00004597 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 56226-95-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FEANS0009.mol |
| 5,6,4'-Trihydroxy-3,7-dimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,6-Dihydroxy-2- (4-hydroxyphenyl) -3,7-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C17H14O7 |
| Exact Mass | 330.073952802 |
| Average Mass | 330.28886 |
| SMILES | COc(c1)c(O)c(O)c(C(=O)2)c1OC(c(c3)ccc(O)c3)=C(OC)2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
