FL5FACGL0060
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=3,5,7,3',4'-Pentahydroxyflavone 3-(6"-ferulylglucoside) | |SysName=3,5,7,3',4'-Pentahydroxyflavone 3-(6"-ferulylglucoside) | ||
| − | |Common Name=&&Quercetin 3-(6"-ferulylglucoside) && | + | |Common Name=&&Quercetin 3-(6"-ferulylglucoside)&&3,5,7,3',4'-Pentahydroxyflavone 3-(6"-ferulylglucoside)&& |
|CAS=153874-56-7 | |CAS=153874-56-7 | ||
|KNApSAcK=C00005962 | |KNApSAcK=C00005962 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 153874-56-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FACGL0060.mol |
| Quercetin 3-(6"-ferulylglucoside) | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7,3',4'-Pentahydroxyflavone 3-(6"-ferulylglucoside) |
| Common Name |
|
| Symbol | |
| Formula | C31H28O15 |
| Exact Mass | 640.1428202259999 |
| Average Mass | 640.54502 |
| SMILES | O(C(COC(=O)C=Cc(c5)cc(c(O)c5)OC)4)C(C(C(C4O)O)O)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
