FL5FA9NS0003
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=5,7-Dihydroxy-3-methoxy-2-phenyl-4H-1-benzopyran-4-one | |SysName=5,7-Dihydroxy-3-methoxy-2-phenyl-4H-1-benzopyran-4-one | ||
− | |Common Name=&& | + | |Common Name=&&3-Methylgalangin&&5,7-Dihydroxy-3-methoxyflavone&&Galangin 3-methyl ether&&5,7-Dihydroxy-3-methoxy-2-phenyl-4H-1-benzopyran-4-one&& |
|CAS=6665-74-3 | |CAS=6665-74-3 | ||
|KNApSAcK=C00004534 | |KNApSAcK=C00004534 | ||
}} | }} |
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 6665-74-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FA9NS0003.mol |
3-Methylgalangin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 5,7-Dihydroxy-3-methoxy-2-phenyl-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C16H12O5 |
Exact Mass | 284.068473494 |
Average Mass | 284.26348 |
SMILES | COC(C(=O)2)=C(Oc(c3)c(c(O)cc(O)3)2)c(c1)cccc1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |