FL4DALNS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2R)-2alpha-(2,4-Dihydroxyphenyl)-3beta,5,7-trihydroxy-2H-1-benzopyran-4(3H)-one | + | |SysName= (2R) -2alpha- (2,4-Dihydroxyphenyl) -3beta,5,7-trihydroxy-2H-1-benzopyran-4 (3H) -one |
| − | |Common Name=&&Dihydromorin&&(2R)-2alpha-(2,4-Dihydroxyphenyl)-3beta,5,7-trihydroxy-2H-1-benzopyran-4(3H)-one&& | + | |Common Name=&&Dihydromorin&& (2R) -2alpha- (2,4-Dihydroxyphenyl) -3beta,5,7-trihydroxy-2H-1-benzopyran-4 (3H) -one&& |
|CAS=18422-83-8 | |CAS=18422-83-8 | ||
|KNApSAcK=C00008570 | |KNApSAcK=C00008570 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 18422-83-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DALNS0001.mol |
| Dihydromorin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R) -2alpha- (2,4-Dihydroxyphenyl) -3beta,5,7-trihydroxy-2H-1-benzopyran-4 (3H) -one |
| Common Name |
|
| Symbol | |
| Formula | C15H12O7 |
| Exact Mass | 304.058302738 |
| Average Mass | 304.25158 |
| SMILES | Oc(c3)cc(O)c(c3)C(O1)C(O)C(=O)c(c(O)2)c(cc(O)c2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
