FL3FGCNS0004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=Sideritiflavone | + | |SysName=Sideritiflavone |
|Common Name=&&Sideritiflavone&&5,3',4'-Trihydroxy-6,7,8-trimethoxyflavone&&2-(3,4-Dihydroxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one&& | |Common Name=&&Sideritiflavone&&5,3',4'-Trihydroxy-6,7,8-trimethoxyflavone&&2-(3,4-Dihydroxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one&& | ||
|CAS=70360-12-2 | |CAS=70360-12-2 | ||
|KNApSAcK=C00003927 | |KNApSAcK=C00003927 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 70360-12-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FGCNS0004.mol |
| Sideritiflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Sideritiflavone |
| Common Name |
|
| Symbol | |
| Formula | C18H16O8 |
| Exact Mass | 360.08451748799996 |
| Average Mass | 360.31484 |
| SMILES | c(C(O2)=CC(c(c3O)c2c(c(c3OC)OC)OC)=O)(c1)cc(O)c(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
