FL3FF8NS0006
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
| {{Metabolite | {{Metabolite | ||
| |SysName=5-Hydroxy-2-(3-hydroxy-2-methoxyphenyl)-7,8-dimethoxy-4H-1-benzopyran-4-one | |SysName=5-Hydroxy-2-(3-hydroxy-2-methoxyphenyl)-7,8-dimethoxy-4H-1-benzopyran-4-one | ||
| − | |Common Name=&&Wightin&& | + | |Common Name=&&Wightin&&5-Hydroxy-2-(3-hydroxy-2-methoxyphenyl)-7,8-dimethoxy-4H-1-benzopyran-4-one&& | 
| |CAS=4825-18-7 | |CAS=4825-18-7 | ||
| |KNApSAcK=C00003899 | |KNApSAcK=C00003899 | ||
| }} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 4825-18-7 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FF8NS0006.mol | 
| Wightin | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | 5-Hydroxy-2-(3-hydroxy-2-methoxyphenyl)-7,8-dimethoxy-4H-1-benzopyran-4-one | 
| Common Name | 
 | 
| Symbol | |
| Formula | C18H16O7 | 
| Exact Mass | 344.089602866 | 
| Average Mass | 344.31543999999997 | 
| SMILES | c(c1OC)(OC)cc(c(C(=O)2)c(OC(c(c(OC)3)cccc3O)=C2)1) | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | 
