FL3FECNS0015
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 21764-09-0 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FECNS0015.mol | 
| 6-Hydroxyluteolin 5,6,7,4'-tetramethyl ether | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | 6-Hydroxyluteolin 5,6,7,4'-tetramethyl ether | 
| Common Name | 
 | 
| Symbol | |
| Formula | C19H18O7 | 
| Exact Mass | 358.10525293 | 
| Average Mass | 358.34202000000005 | 
| SMILES | c(c1OC)c(O2)c(C(=O)C=C2c(c3)cc(O)c(OC)c3)c(c1OC)OC | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
| 
 | 
