FL3FAANI0004
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one | + | |SysName=5,7-Dihydroxy-2- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
− | |Common Name=&&6-Prenylapigenin&&5,7,4'-Trihydroxy-6-prenylflavone&&6-C-Prenylapigenin&&5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one&& | + | |Common Name=&&6-Prenylapigenin&&5,7,4'-Trihydroxy-6-prenylflavone&&6-C-Prenylapigenin&&5,7-Dihydroxy-2- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one&& |
|CAS=68097-13-2 | |CAS=68097-13-2 | ||
|KNApSAcK=C00004089 | |KNApSAcK=C00004089 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 68097-13-2 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FAANI0004.mol |
6-Prenylapigenin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 5,7-Dihydroxy-2- (4-hydroxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C20H18O5 |
Exact Mass | 338.115423686 |
Average Mass | 338.35392 |
SMILES | C(=O)(C=1)c(c3O)c(cc(c(CC=C(C)C)3)O)OC1c(c2)ccc(O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|