FL3F99NS0002
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 548-58-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3F99NS0002.mol |
Primetin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Primetin |
Common Name |
|
Symbol | |
Formula | C15H10O4 |
Exact Mass | 254.05790880799998 |
Average Mass | 254.2375 |
SMILES | Oc(c3)c(O1)c(c(O)c3)C(=O)C=C1c(c2)cccc2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|