FL2FAANF0004
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
| {{Metabolite | {{Metabolite | ||
| |SysName= (S) -2- (4-Hydroxyphenyl) -5-hydroxy-6- (3-methyl-2-butenyl) -8- (1-methyl-1-hydroxyethyl) -2H-furo [ 2,3-h ] -1-benzopyran-4 (3H) -one | |SysName= (S) -2- (4-Hydroxyphenyl) -5-hydroxy-6- (3-methyl-2-butenyl) -8- (1-methyl-1-hydroxyethyl) -2H-furo [ 2,3-h ] -1-benzopyran-4 (3H) -one | ||
Revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FAA Naringenin (106 pages) : FL2FAANF Furanoflavonoid (11 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 162616-69-5 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FAANF0004.mol | 
| Lupinenol | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | (S) -2- (4-Hydroxyphenyl) -5-hydroxy-6- (3-methyl-2-butenyl) -8- (1-methyl-1-hydroxyethyl) -2H-furo [ 2,3-h ] -1-benzopyran-4 (3H) -one | 
| Common Name | 
 | 
| Symbol | |
| Formula | C25H26O6 | 
| Exact Mass | 422.172938564 | 
| Average Mass | 422.47033999999996 | 
| SMILES | c(c23)(OC(c(c4)ccc(c4)O)CC3=O)c(c1c(c2O)CC=C(C)C)c | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
| 
 | 
