FL2FA9GS0009
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2S)-7-O-beta-D-glucopyranosyl-5-hydroxyflavanone | + | |SysName= (2S) -7-O-beta-D-glucopyranosyl-5-hydroxyflavanone |
| − | |Common Name=&&Pinocembrin 7-O-beta-D-glucoside&&Pinocembroside&&(2S)-7-O-beta-D-glucopyranosyl-5-hydroxyflavanone&& | + | |Common Name=&&Pinocembrin 7-O-beta-D-glucoside&&Pinocembroside&& (2S) -7-O-beta-D-glucopyranosyl-5-hydroxyflavanone&& |
|CAS=75829-43-5 | |CAS=75829-43-5 | ||
|KNApSAcK=C00014304 | |KNApSAcK=C00014304 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 75829-43-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FA9GS0009.mol |
| Pinocembrin 7-O-beta-D-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2S) -7-O-beta-D-glucopyranosyl-5-hydroxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C21H22O9 |
| Exact Mass | 418.126382302 |
| Average Mass | 418.39398 |
| SMILES | C(C3)(c(c4)cccc4)Oc(c2C(=O)3)cc(cc(O)2)OC(O1)C(O)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
