FL2F1ANI0004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=7,4'-Dihydroxy-3'-C-prenylflavanone | |SysName=7,4'-Dihydroxy-3'-C-prenylflavanone | ||
| − | |Common Name=&&Abyssinone II&& | + | |Common Name=&&Abyssinone II&&7,4'-Dihydroxy-3'-C-prenylflavanone&& |
|CAS=77263-08-2 | |CAS=77263-08-2 | ||
|KNApSAcK=C00008201 | |KNApSAcK=C00008201 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 77263-08-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2F1ANI0004.mol |
| Abyssinone II | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7,4'-Dihydroxy-3'-C-prenylflavanone |
| Common Name |
|
| Symbol | |
| Formula | C20H20O4 |
| Exact Mass | 324.136159128 |
| Average Mass | 324.37039999999996 |
| SMILES | c(O)(c3)ccc(c32)C(=O)CC(O2)c(c1)cc(c(O)c1)CC=C(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
