FL1CQUNM0005
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=[(1R)-5-Oxo-6-(1-hydroxy-3-phenyl-2-propenylidene)-3-cyclohexenyl]acetic acid methyl ester | + | |SysName= [ (1R) -5-Oxo-6- (1-hydroxy-3-phenyl-2-propenylidene) -3-cyclohexenyl ] acetic acid methyl ester |
| − | |Common Name=&&Infectocaryone&&[(1R)-5-Oxo-6-(1-hydroxy-3-phenyl-2-propenylidene)-3-cyclohexenyl]acetic acid methyl ester&& | + | |Common Name=&&Infectocaryone&& [ (1R) -5-Oxo-6- (1-hydroxy-3-phenyl-2-propenylidene) -3-cyclohexenyl ] acetic acid methyl ester&& |
|CAS=371194-02-4 | |CAS=371194-02-4 | ||
|KNApSAcK=C00014584 | |KNApSAcK=C00014584 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 371194-02-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CQUNM0005.mol |
| Infectocaryone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | [ (1R) -5-Oxo-6- (1-hydroxy-3-phenyl-2-propenylidene) -3-cyclohexenyl ] acetic acid methyl ester |
| Common Name |
|
| Symbol | |
| Formula | C18H18O4 |
| Exact Mass | 298.120509064 |
| Average Mass | 298.33312 |
| SMILES | C(C1=C(O)C=Cc(c2)cccc2)(CC=CC1=O)CC(=O)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
