FL1CHYNS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |Sysname=2'-beta-Dihydroxychalcone |
|Common Name=&&2'-beta-Dihydroxychalcone&& | |Common Name=&&2'-beta-Dihydroxychalcone&& | ||
|CAS=39103-33-8 | |CAS=39103-33-8 | ||
|KNApSAcK=C00006993 | |KNApSAcK=C00006993 | ||
}} | }} | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 39103-33-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CHYNS0001.mol |
| 2'-beta-Dihydroxychalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | |
| Common Name |
|
| Symbol | |
| Formula | C15H12O3 |
| Exact Mass | 240.07864425 |
| Average Mass | 240.25398 |
| SMILES | Oc(c2)c(ccc2)C(=O)C=C(O)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
