FL1CHYNM0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |Sysname=3'-Formyl-2',6',beta-trihydroxy-4'-methoxy-5'-methylchalcone |
|Common Name=&&3'-Formyl-2',6',beta-trihydroxy-4'-methoxy-5'-methylchalcone && | |Common Name=&&3'-Formyl-2',6',beta-trihydroxy-4'-methoxy-5'-methylchalcone && | ||
|CAS=59677-77-9 | |CAS=59677-77-9 | ||
|KNApSAcK=C00006999 | |KNApSAcK=C00006999 | ||
}} | }} | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 59677-77-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CHYNM0001.mol |
| 3'-Formyl-2',6',beta-trihydroxy-4'-methoxy-5'-methylchalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | |
| Common Name |
|
| Symbol | |
| Formula | C18H16O6 |
| Exact Mass | 328.094688244 |
| Average Mass | 328.31604 |
| SMILES | C(c(c2O)c(c(c(c2C)OC)C=O)O)(=O)C=C(O)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
