FL1CHYNI0002
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 107390-47-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1CHYNI0002.mol |
5'-Prenyllicodione | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 4,2',4',beta-Tetrahydroxy-5'-prenylchalcone |
Common Name |
|
Symbol | |
Formula | C20H20O5 |
Exact Mass | 340.13107375 |
Average Mass | 340.3698 |
SMILES | c(c1)(C(CC(=O)c(c2)ccc(O)c2)=O)c(cc(O)c1CC=C(C)C)O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
[show] Species-Flavonoid Relationship Reported |
---|