FL1CE9NS0007
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=2',6'-Dimethoxy-3',4'-methylenedioxychalcone | |SysName=2',6'-Dimethoxy-3',4'-methylenedioxychalcone | ||
| − | |Common Name=&&Helilandin A&& | + | |Common Name=&&Helilandin A&&2',6'-Dimethoxy-3',4'-methylenedioxychalcone&& |
|CAS=70185-50-1 | |CAS=70185-50-1 | ||
|KNApSAcK=C00007026 | |KNApSAcK=C00007026 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 70185-50-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CE9NS0007.mol |
| Helilandin A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2',6'-Dimethoxy-3',4'-methylenedioxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C18H16O5 |
| Exact Mass | 312.099773622 |
| Average Mass | 312.31664 |
| SMILES | C(c(c(OC)3)c(c(c2c3)OCO2)OC)(=O)C=Cc(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
