FL1CA9NP0006
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 20890-68-0 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CA9NP0006.mol | 
| 2',4'-Dihydroxy-3',6",6"-trimethylpyrano[2",3":6',5']chalcone | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | 2',4'-Dihydroxy-3',6",6"-trimethylpyrano[2",3":6',5']chalcone | 
| Common Name | 
 | 
| Symbol | |
| Formula | C21H20O4 | 
| Exact Mass | 336.136159128 | 
| Average Mass | 336.38109999999995 | 
| SMILES | c(c23)(OC(C=C3)(C)C)c(c(c(c(O)2)C)O)C(=O)C=Cc(c1)c | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
| 
 | 
