FL1C1ANF0003
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
| {{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=3-(4-Hydroxyphenyl)-1-[(2S)-2,3-dihydro-3beta,4-dihydroxy-2alpha-(1-hydroxy-1-methylethyl)benzo[b]furan-5-yl]-2-propene-1-one | 
| |Common Name=&&Brosimacutin G&& | |Common Name=&&Brosimacutin G&& | ||
| |CAS=350221-50-0 | |CAS=350221-50-0 | ||
| |KNApSAcK=C00011118 | |KNApSAcK=C00011118 | ||
| }} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 350221-50-0 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C1ANF0003.mol | 
| Brosimacutin G | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | 3-(4-Hydroxyphenyl)-1-[(2S)-2,3-dihydro-3beta,4-dihydroxy-2alpha-(1-hydroxy-1-methylethyl)benzo[b]furan-5-yl]-2-propene-1-one | 
| Common Name | 
 | 
| Symbol | |
| Formula | C20H20O6 | 
| Exact Mass | 356.125988372 | 
| Average Mass | 356.3692 | 
| SMILES | C(C)(C)(O)C(C3O)Oc(c23)ccc(c2O)C(=O)C=Cc(c1)ccc(O) | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
| 
 | 
