Capsaicin
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=(6E)-, N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methyl-, 6-Nonenamide |Common Name=&&Capsaicin&&(E)-, 8-methyl-N-vanillyl-, 6-Nonenamide&&...) |
|||
| Line 2: | Line 2: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(6E)-, N-[(4-hydroxy-3-methoxyphenyl) | + | |SysName=(6E)-, N-[(4-hydroxy-3-methoxyphenyl)Methyl]-8-methyl-, 6-nonenamide |
| − | |Common Name=&&Capsaicin&&(E)-, 8- | + | |Common Name=&&Capsaicin&&(E)-, 8-Methyl-N-vanillyl-, 6-nonenamide&&(E)-, N-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methyl-, 6-nonenamide&&(E)-N-(4-Hydroxy-3-methoxybenzyl)-8-methylnon-6-enamide&&ALGRX 4975&&Adlea&&Axsain&&Capsaicine&&Capsin P 50&&Capzasin-HP&&Dolenon&&E-Capsaicin&&Mioton&&N-(4-Oxy-3-methoxybenzyl)-8-methyl-6-nonenamide&&Zostrix&&trans-8-Methyl-N-vanillyl-6-nonenamide&& |
|CAS=404-86-4 | |CAS=404-86-4 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
Revision as of 16:21, 14 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 404-86-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Capsaicin.mol |
| Capsaicin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (6E)-, N-[(4-hydroxy-3-methoxyphenyl)Methyl]-8-methyl-, 6-nonenamide |
| Common Name |
|
| Symbol | |
| Formula | C18H27NO3 |
| Exact Mass | 305.199093735 |
| Average Mass | 305.41192 |
| SMILES | CC(C)C=CCCCCC(=O)NCc(c1)cc(OC)c(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
